C15H14N4O2 — CID 3232736
8-[2-(2-methoxyphenyl)ethyl]pteridin-7-one (PubChem CID 3232736) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 8-[2-(2-methoxyphenyl)ethyl]pteridin-7-one.
| Compound Name | 8-[2-(2-methoxyphenyl)ethyl]pteridin-7-one |
|---|---|
| PubChem CID | 3232736 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 8-[2-(2-methoxyphenyl)ethyl]pteridin-7-one |
| SMILES | COc1ccccc1CCn1c(=O)cnc2cncnc21 |
| InChI | InChI=1S/C15H14N4O2/c1-21-13-5-3-2-4-11(13)6-7-19-14(20)9-17-12-8-16-10-18-15(12)19/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | RDYXUOMIVUWDEF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |