C24H21N7O2 — CID 3232760
3-[8-(4-methoxyphenyl)-7-oxo-2-piperazin-1-ylpteridin-6-yl]benzonitrile (PubChem CID 3232760) has the molecular formula C24H21N7O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 3-[8-(4-methoxyphenyl)-7-oxo-2-piperazin-1-ylpteridin-6-yl]benzonitrile.
| Compound Name | 3-[8-(4-methoxyphenyl)-7-oxo-2-piperazin-1-ylpteridin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 3232760 |
| Molecular Formula | C24H21N7O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[8-(4-methoxyphenyl)-7-oxo-2-piperazin-1-ylpteridin-6-yl]benzonitrile |
| SMILES | COc1ccc(-n2c(=O)c(-c3cccc(C#N)c3)nc3cnc(N4CCNCC4)nc32)cc1 |
| InChI | InChI=1S/C24H21N7O2/c1-33-19-7-5-18(6-8-19)31-22-20(15-27-24(29-22)30-11-9-26-10-12-30)28-21(23(31)32)17-4-2-3-16(13-17)14-25/h2-8,13,15,26H,9-12H2,1H3 |
| InChIKey | SWMHYVXJFQIYOL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |