C21H17ClN4O3 — CID 3233566
2-(3-chlorophenoxy)-8-(2-methoxyethyl)-6-phenylpteridin-7-one (PubChem CID 3233566) has the molecular formula C21H17ClN4O3 and a molecular weight of 408.85 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-8-(2-methoxyethyl)-6-phenylpteridin-7-one.
| Compound Name | 2-(3-chlorophenoxy)-8-(2-methoxyethyl)-6-phenylpteridin-7-one |
|---|---|
| PubChem CID | 3233566 |
| Molecular Formula | C21H17ClN4O3 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-(3-chlorophenoxy)-8-(2-methoxyethyl)-6-phenylpteridin-7-one |
| SMILES | COCCn1c(=O)c(-c2ccccc2)nc2cnc(Oc3cccc(Cl)c3)nc21 |
| InChI | InChI=1S/C21H17ClN4O3/c1-28-11-10-26-19-17(24-18(20(26)27)14-6-3-2-4-7-14)13-23-21(25-19)29-16-9-5-8-15(22)12-16/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | OHSZAONIMAVXSO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |