C25H26N6O3 — CID 3234292
6,8-bis(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-7-one (PubChem CID 3234292) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 6,8-bis(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-7-one.
| Compound Name | 6,8-bis(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-7-one |
|---|---|
| PubChem CID | 3234292 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 6,8-bis(4-methoxyphenyl)-2-(4-methylpiperazin-1-yl)pteridin-7-one |
| SMILES | COc1ccc(-c2nc3cnc(N4CCN(C)CC4)nc3n(-c3ccc(OC)cc3)c2=O)cc1 |
| InChI | InChI=1S/C25H26N6O3/c1-29-12-14-30(15-13-29)25-26-16-21-23(28-25)31(18-6-10-20(34-3)11-7-18)24(32)22(27-21)17-4-8-19(33-2)9-5-17/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | MWORENZCEPQGMT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |