C22H20N4O2 — CID 3235011
N-[(2,4-dimethoxyphenyl)methyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 3235011) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 3235011 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COc1ccc(CNc2nc(-c3cccnc3)nc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C22H20N4O2/c1-27-17-10-9-15(20(12-17)28-2)14-24-22-18-7-3-4-8-19(18)25-21(26-22)16-6-5-11-23-13-16/h3-13H,14H2,1-2H3,(H,24,25,26) |
| InChIKey | SJVJSPWKPCUULI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |