C17H25N3O3S2 — CID 3236379
3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-ethylhexyl)propanamide (PubChem CID 3236379) has the molecular formula C17H25N3O3S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-ethylhexyl)propanamide.
| Compound Name | 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-ethylhexyl)propanamide |
|---|---|
| PubChem CID | 3236379 |
| Molecular Formula | C17H25N3O3S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-ethylhexyl)propanamide |
| SMILES | CCCCC(CC)CNC(=O)CCS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C17H25N3O3S2/c1-3-5-7-13(4-2)12-18-16(21)10-11-25(22,23)15-9-6-8-14-17(15)20-24-19-14/h6,8-9,13H,3-5,7,10-12H2,1-2H3,(H,18,21) |
| InChIKey | UUTFECAUBNAERP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |