C15H19N3O3S — CID 3239877
N-cycloheptyl-2-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)acetamide (PubChem CID 3239877) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-cycloheptyl-2-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 3239877 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-cycloheptyl-2-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)[nH]c2ccsc2c1=O)NC1CCCCCC1 |
| InChI | InChI=1S/C15H19N3O3S/c19-12(16-10-5-3-1-2-4-6-10)9-18-14(20)13-11(7-8-22-13)17-15(18)21/h7-8,10H,1-6,9H2,(H,16,19)(H,17,21) |
| InChIKey | CPJLYURHVVPBMP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |