C23H33N5O5S — CID 3240233
N-[3-(N-ethyl-3-methylanilino)propyl]-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-4-carboxamide (PubChem CID 3240233) has the molecular formula C23H33N5O5S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3240233 |
| Molecular Formula | C23H33N5O5S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-1-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-4-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CCN(S(=O)(=O)c2c(C)[nH]c(=O)[nH]c2=O)CC1)c1cccc(C)c1 |
| InChI | InChI=1S/C23H33N5O5S/c1-4-27(19-8-5-7-16(2)15-19)12-6-11-24-21(29)18-9-13-28(14-10-18)34(32,33)20-17(3)25-23(31)26-22(20)30/h5,7-8,15,18H,4,6,9-14H2,1-3H3,(H,24,29)(H2,25,26,30,31) |
| InChIKey | GOIMQEDDXMLXJB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|