C21H22N2O3 — CID 3242710
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 3242710) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 3242710 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C21H22N2O3/c24-17(22-16-7-3-5-12-4-1-2-6-15(12)16)11-23-20(25)18-13-8-9-14(10-13)19(18)21(23)26/h1-2,4,6,8-9,13-14,16,18-19H,3,5,7,10-11H2,(H,22,24) |
| InChIKey | UDICIPZKIVPQEI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|