C25H19N3O4 — CID 3242793
benzyl 6'-amino-5'-cyano-2'-methyl-2-oxo-1-prop-2-ynylspiro[indole-3,4'-pyran]-3'-carboxylate (PubChem CID 3242793) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is benzyl 6'-amino-5'-cyano-2'-methyl-2-oxo-1-prop-2-ynylspiro[indole-3,4'-pyran]-3'-carboxylate.
| Compound Name | benzyl 6'-amino-5'-cyano-2'-methyl-2-oxo-1-prop-2-ynylspiro[indole-3,4'-pyran]-3'-carboxylate |
|---|---|
| PubChem CID | 3242793 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | benzyl 6'-amino-5'-cyano-2'-methyl-2-oxo-1-prop-2-ynylspiro[indole-3,4'-pyran]-3'-carboxylate |
| SMILES | C#CCN1C(=O)C2(C(C#N)=C(N)OC(C)=C2C(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H19N3O4/c1-3-13-28-20-12-8-7-11-18(20)25(24(28)30)19(14-26)22(27)32-16(2)21(25)23(29)31-15-17-9-5-4-6-10-17/h1,4-12H,13,15,27H2,2H3 |
| InChIKey | LKTWHQLGBLDGCK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|