About 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride
1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride (PubChem CID 3243519) has the molecular formula C16H26ClNO3
and a molecular weight of 315.84 g/mol. Its IUPAC name is 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride.
Molecular Properties
| Compound Name | 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride |
| PubChem CID | 3243519 |
| Molecular Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride |
| SMILES | CCCCOc1ccc(C(=O)OC(C)CN(C)C)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C16H25NO3.ClH/c1-5-6-11-19-15-9-7-14(8-10-15)16(18)20-13(2)12-17(3)4;/h7-10,13H,5-6,11-12H2,1-4H3;1H |
| InChIKey | QLBDLLNDZOATJD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride?
The IUPAC name of 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride (CID 3243519) is 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride.
What is the SMILES notation for 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride?
The canonical SMILES for 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride is CCCCOc1ccc(C(=O)OC(C)CN(C)C)cc1.[Cl-].[H+].
What is the InChIKey of 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride?
The InChIKey is QLBDLLNDZOATJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3.ClH/c1-5-6-11-19-15-9-7-14(8-10-15)16(18)20-13(2)12-17(3)4;/h7-10,13H,5-6,11-12H2,1-4H3;1H.
What are the key properties of 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride?
1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride has a molecular weight of 315.84 g/mol, XLogP of 0.09, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)propan-2-yl 4-butoxybenzoate;hydron;chloride is sourced from PubChem (CID 3243519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).