C21H22N4O4 — CID 3244252
4-N,5-N-bis(2-ethoxyphenyl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 3244252) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-N,5-N-bis(2-ethoxyphenyl)-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-bis(2-ethoxyphenyl)-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 3244252 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-N,5-N-bis(2-ethoxyphenyl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1nc[nH]c1C(=O)Nc1ccccc1OCC |
| InChI | InChI=1S/C21H22N4O4/c1-3-28-16-11-7-5-9-14(16)24-20(26)18-19(23-13-22-18)21(27)25-15-10-6-8-12-17(15)29-4-2/h5-13H,3-4H2,1-2H3,(H,22,23)(H,24,26)(H,25,27) |
| InChIKey | SZCYGZRZCQFSST-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |