C20H26N4O6S — CID 3245220
ethyl 2-[[2-[6-(4-methylpiperidin-1-yl)sulfonyl-4-oxoquinazolin-3-yl]acetyl]amino]acetate (PubChem CID 3245220) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is ethyl 2-[[2-[6-(4-methylpiperidin-1-yl)sulfonyl-4-oxoquinazolin-3-yl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[6-(4-methylpiperidin-1-yl)sulfonyl-4-oxoquinazolin-3-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 3245220 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | ethyl 2-[[2-[6-(4-methylpiperidin-1-yl)sulfonyl-4-oxoquinazolin-3-yl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)Cn1cnc2ccc(S(=O)(=O)N3CCC(C)CC3)cc2c1=O |
| InChI | InChI=1S/C20H26N4O6S/c1-3-30-19(26)11-21-18(25)12-23-13-22-17-5-4-15(10-16(17)20(23)27)31(28,29)24-8-6-14(2)7-9-24/h4-5,10,13-14H,3,6-9,11-12H2,1-2H3,(H,21,25) |
| InChIKey | VOIINMGMOJAYFX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |