C21H17FN2O4S — CID 32566324
2-(4-fluorobenzoyl)-N-[(3-sulfamoylphenyl)methyl]benzamide (PubChem CID 32566324) has the molecular formula C21H17FN2O4S and a molecular weight of 412.44 g/mol. Its IUPAC name is 2-(4-fluorobenzoyl)-N-[(3-sulfamoylphenyl)methyl]benzamide.
| Compound Name | 2-(4-fluorobenzoyl)-N-[(3-sulfamoylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 32566324 |
| Molecular Formula | C21H17FN2O4S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-(4-fluorobenzoyl)-N-[(3-sulfamoylphenyl)methyl]benzamide |
| SMILES | NS(=O)(=O)c1cccc(CNC(=O)c2ccccc2C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H17FN2O4S/c22-16-10-8-15(9-11-16)20(25)18-6-1-2-7-19(18)21(26)24-13-14-4-3-5-17(12-14)29(23,27)28/h1-12H,13H2,(H,24,26)(H2,23,27,28) |
| InChIKey | POMDVZWSQSQXIZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |