C20H19N3O5 — CID 32567973
(E)-3-(1,3-benzodioxol-5-yl)-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylprop-2-enamide (PubChem CID 32567973) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 32567973 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-N-propylprop-2-enamide |
| SMILES | CCCN(Cc1nnc(-c2ccco2)o1)C(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19N3O5/c1-2-9-23(12-18-21-22-20(28-18)16-4-3-10-25-16)19(24)8-6-14-5-7-15-17(11-14)27-13-26-15/h3-8,10-11H,2,9,12-13H2,1H3/b8-6+ |
| InChIKey | RDQPLQMCJZXZEK-SOFGYWHQSA-N |
| XLogP | 3.51 |
| TPSA | 90.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|