C14H12Cl3N5O3 — CID 3261889
2-ethoxy-N-[3,4,4-trichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]aniline (PubChem CID 3261889) has the molecular formula C14H12Cl3N5O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-ethoxy-N-[3,4,4-trichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]aniline.
| Compound Name | 2-ethoxy-N-[3,4,4-trichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 3261889 |
| Molecular Formula | C14H12Cl3N5O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-ethoxy-N-[3,4,4-trichloro-2-nitro-1-(1,2,4-triazol-1-yl)buta-1,3-dienyl]aniline |
| SMILES | CCOc1ccccc1NC(=C(C(Cl)=C(Cl)Cl)[N+](=O)[O-])n1cncn1 |
| InChI | InChI=1S/C14H12Cl3N5O3/c1-2-25-10-6-4-3-5-9(10)20-14(21-8-18-7-19-21)12(22(23)24)11(15)13(16)17/h3-8,20H,2H2,1H3 |
| InChIKey | ONMKSIHVAQJEND-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|