C29H34N6O — CID 32624969
N-[4-(4-benzylpiperazin-1-yl)phenyl]-1,3-dimethyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 32624969) has the molecular formula C29H34N6O and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-1,3-dimethyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1,3-dimethyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 32624969 |
| Molecular Formula | C29H34N6O |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1,3-dimethyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C)c2nc(C(C)C)cc(C(=O)Nc3ccc(N4CCN(Cc5ccccc5)CC4)cc3)c12 |
| InChI | InChI=1S/C29H34N6O/c1-20(2)26-18-25(27-21(3)32-33(4)28(27)31-26)29(36)30-23-10-12-24(13-11-23)35-16-14-34(15-17-35)19-22-8-6-5-7-9-22/h5-13,18,20H,14-17,19H2,1-4H3,(H,30,36) |
| InChIKey | XCUMXDVKLOFVMP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|