C25H27N3 — CID 32668562
3-[N-methyl-4-[[[(R)-(4-methylphenyl)-phenylmethyl]amino]methyl]anilino]propanenitrile (PubChem CID 32668562) has the molecular formula C25H27N3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-[N-methyl-4-[[[(R)-(4-methylphenyl)-phenylmethyl]amino]methyl]anilino]propanenitrile.
| Compound Name | 3-[N-methyl-4-[[[(R)-(4-methylphenyl)-phenylmethyl]amino]methyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 32668562 |
| Molecular Formula | C25H27N3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 3-[N-methyl-4-[[[(R)-(4-methylphenyl)-phenylmethyl]amino]methyl]anilino]propanenitrile |
| SMILES | Cc1ccc([C@H](NCc2ccc(N(C)CCC#N)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27N3/c1-20-9-13-23(14-10-20)25(22-7-4-3-5-8-22)27-19-21-11-15-24(16-12-21)28(2)18-6-17-26/h3-5,7-16,25,27H,6,18-19H2,1-2H3/t25-/m1/s1 |
| InChIKey | KILCSKPOEFYYHR-RUZDIDTESA-N |
| XLogP | 5.22 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|