C24H19Cl4N3O3 — CID 3271904
3,4-dichloro-N-[3-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide (PubChem CID 3271904) has the molecular formula C24H19Cl4N3O3 and a molecular weight of 539.25 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 3271904 |
| Molecular Formula | C24H19Cl4N3O3 |
| Molecular Weight | 539.25 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccc(Cl)c(Cl)c1)NN=Cc1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H19Cl4N3O3/c25-18-5-3-17(21(27)12-18)14-34-19-6-1-15(2-7-19)13-30-31-23(32)9-10-29-24(33)16-4-8-20(26)22(28)11-16/h1-8,11-13H,9-10,14H2,(H,29,33)(H,31,32) |
| InChIKey | DQXOWAIHFSVTGT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.25 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|