C35H57NO5 — CID 3272508
(5-methyl-2-propan-2-ylcyclohexyl) N-[(3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-N-(3-methoxypropyl)carbamate (PubChem CID 3272508) has the molecular formula C35H57NO5 and a molecular weight of 571.84 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-[(3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-N-(3-methoxypropyl)carbamate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[(3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 3272508 |
| Molecular Formula | C35H57NO5 |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 571.42 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-[(3,17-dihydroxy-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)methyl]-N-(3-methoxypropyl)carbamate |
| SMILES | COCCCN(CC1(O)CCC2C3=CC=C4CC(O)CCC4(C)C3CCC21C)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C35H57NO5/c1-23(2)27-10-8-24(3)20-31(27)41-32(38)36(18-7-19-40-6)22-35(39)17-14-30-28-11-9-25-21-26(37)12-15-33(25,4)29(28)13-16-34(30,35)5/h9,11,23-24,26-27,29-31,37,39H,7-8,10,12-22H2,1-6H3 |
| InChIKey | HMBARLPOKSGRMI-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|