C34H53NO4 — CID 3663721
17-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 3663721) has the molecular formula C34H53NO4 and a molecular weight of 539.80 g/mol. Its IUPAC name is 17-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 17-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 3663721 |
| Molecular Formula | C34H53NO4 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.40 |
| IUPAC Name | 17-[[1-adamantylmethyl(2,3-dihydroxypropyl)amino]methyl]-10,13-dimethyl-1,2,3,4,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC12CCC(O)CC1=CC=C1C2CCC2(C)C1CCC2(O)CN(CC(O)CO)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C34H53NO4/c1-31-8-5-26(37)14-25(31)3-4-28-29(31)6-9-32(2)30(28)7-10-34(32,39)21-35(18-27(38)19-36)20-33-15-22-11-23(16-33)13-24(12-22)17-33/h3-4,22-24,26-27,29-30,36-39H,5-21H2,1-2H3 |
| InChIKey | DAXZHSYKSGVDPP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |