C23H38N2OS — CID 3274739
1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropane-2-thiol (PubChem CID 3274739) has the molecular formula C23H38N2OS and a molecular weight of 390.64 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropane-2-thiol.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropane-2-thiol |
|---|---|
| PubChem CID | 3274739 |
| Molecular Formula | C23H38N2OS |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropane-2-thiol |
| SMILES | CC1CC(OCC(S)CN2CCN(Cc3ccccc3)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C23H38N2OS/c1-19-13-21(15-23(2,3)14-19)26-18-22(27)17-25-11-9-24(10-12-25)16-20-7-5-4-6-8-20/h4-8,19,21-22,27H,9-18H2,1-3H3 |
| InChIKey | WLDZQMGFZFFYMS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|