C18H16Cl2N2O3 — CID 32773430
1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-6-methoxyindole-2,3-dione (PubChem CID 32773430) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-6-methoxyindole-2,3-dione.
| Compound Name | 1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-6-methoxyindole-2,3-dione |
|---|---|
| PubChem CID | 32773430 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 1-[[(3,4-dichlorophenyl)methyl-methylamino]methyl]-6-methoxyindole-2,3-dione |
| SMILES | COc1ccc2c(c1)N(CN(C)Cc1ccc(Cl)c(Cl)c1)C(=O)C2=O |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-21(9-11-3-6-14(19)15(20)7-11)10-22-16-8-12(25-2)4-5-13(16)17(23)18(22)24/h3-8H,9-10H2,1-2H3 |
| InChIKey | ABZXXRNUPLIGNW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|