C24H21N3O5S2 — CID 3278284
N-(2,4-dimethoxyphenyl)-2-[2-oxo-3-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide (PubChem CID 3278284) has the molecular formula C24H21N3O5S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[2-oxo-3-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[2-oxo-3-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 3278284 |
| Molecular Formula | C24H21N3O5S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[2-oxo-3-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide |
| SMILES | C=CCN1C(=O)C(=C2C(=O)N(CC(=O)Nc3ccc(OC)cc3OC)c3ccccc32)SC1=S |
| InChI | InChI=1S/C24H21N3O5S2/c1-4-11-26-23(30)21(34-24(26)33)20-15-7-5-6-8-17(15)27(22(20)29)13-19(28)25-16-10-9-14(31-2)12-18(16)32-3/h4-10,12H,1,11,13H2,2-3H3,(H,25,28) |
| InChIKey | ALIGOYVFJCTYDH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|