C31H29N3O6S2 — CID 3666167
2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 3666167) has the molecular formula C31H29N3O6S2 and a molecular weight of 603.72 g/mol. Its IUPAC name is 2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3666167 |
| Molecular Formula | C31H29N3O6S2 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(CCc4ccc(OC)c(OC)c4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H29N3O6S2/c1-4-40-21-12-10-20(11-13-21)32-26(35)18-34-23-8-6-5-7-22(23)27(29(34)36)28-30(37)33(31(41)42-28)16-15-19-9-14-24(38-2)25(17-19)39-3/h5-14,17H,4,15-16,18H2,1-3H3,(H,32,35) |
| InChIKey | IWDZFXHWFIDKTJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|