C31H29N3O7S2 — CID 3670848
N-(2,4-dimethoxyphenyl)-2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide (PubChem CID 3670848) has the molecular formula C31H29N3O7S2 and a molecular weight of 619.72 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide |
|---|---|
| PubChem CID | 3670848 |
| Molecular Formula | C31H29N3O7S2 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-oxoindol-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(CCc4ccc(OC)c(OC)c4)C3=O)c3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C31H29N3O7S2/c1-38-19-10-11-21(24(16-19)40-3)32-26(35)17-34-22-8-6-5-7-20(22)27(29(34)36)28-30(37)33(31(42)43-28)14-13-18-9-12-23(39-2)25(15-18)41-4/h5-12,15-16H,13-14,17H2,1-4H3,(H,32,35) |
| InChIKey | MLHGGBMKFMUBEV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|