C17H16Cl2O4S2 — CID 3281624
[2,2-dichloro-3-[(2-thiophen-2-ylacetyl)oxymethyl]cyclopropyl]methyl 2-thiophen-2-ylacetate (PubChem CID 3281624) has the molecular formula C17H16Cl2O4S2 and a molecular weight of 419.35 g/mol. Its IUPAC name is [2,2-dichloro-3-[(2-thiophen-2-ylacetyl)oxymethyl]cyclopropyl]methyl 2-thiophen-2-ylacetate.
| Compound Name | [2,2-dichloro-3-[(2-thiophen-2-ylacetyl)oxymethyl]cyclopropyl]methyl 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 3281624 |
| Molecular Formula | C17H16Cl2O4S2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | [2,2-dichloro-3-[(2-thiophen-2-ylacetyl)oxymethyl]cyclopropyl]methyl 2-thiophen-2-ylacetate |
| SMILES | O=C(Cc1cccs1)OCC1C(COC(=O)Cc2cccs2)C1(Cl)Cl |
| InChI | InChI=1S/C17H16Cl2O4S2/c18-17(19)13(9-22-15(20)7-11-3-1-5-24-11)14(17)10-23-16(21)8-12-4-2-6-25-12/h1-6,13-14H,7-10H2 |
| InChIKey | HTNQQBOBBOACBS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|