C21H38N4O3 — CID 3287982
3-cyclohexyl-1-(3-cyclohexyl-5,5-dimethyl-2-oxo-1-propylimidazolidin-4-yl)-1-hydroxyurea (PubChem CID 3287982) has the molecular formula C21H38N4O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-cyclohexyl-1-(3-cyclohexyl-5,5-dimethyl-2-oxo-1-propylimidazolidin-4-yl)-1-hydroxyurea.
| Compound Name | 3-cyclohexyl-1-(3-cyclohexyl-5,5-dimethyl-2-oxo-1-propylimidazolidin-4-yl)-1-hydroxyurea |
|---|---|
| PubChem CID | 3287982 |
| Molecular Formula | C21H38N4O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 3-cyclohexyl-1-(3-cyclohexyl-5,5-dimethyl-2-oxo-1-propylimidazolidin-4-yl)-1-hydroxyurea |
| SMILES | CCCN1C(=O)N(C2CCCCC2)C(N(O)C(=O)NC2CCCCC2)C1(C)C |
| InChI | InChI=1S/C21H38N4O3/c1-4-15-23-20(27)24(17-13-9-6-10-14-17)18(21(23,2)3)25(28)19(26)22-16-11-7-5-8-12-16/h16-18,28H,4-15H2,1-3H3,(H,22,26) |
| InChIKey | UZEXAXMDLWULEO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|