C23H42N4O3 — CID 40634215
3-cyclohexyl-1-[(4R)-3-cyclohexyl-5,5-dimethyl-1-(3-methylbutyl)-2-oxoimidazolidin-4-yl]-1-hydroxyurea (PubChem CID 40634215) has the molecular formula C23H42N4O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(4R)-3-cyclohexyl-5,5-dimethyl-1-(3-methylbutyl)-2-oxoimidazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-cyclohexyl-1-[(4R)-3-cyclohexyl-5,5-dimethyl-1-(3-methylbutyl)-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 40634215 |
| Molecular Formula | C23H42N4O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | 3-cyclohexyl-1-[(4R)-3-cyclohexyl-5,5-dimethyl-1-(3-methylbutyl)-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
| SMILES | CC(C)CCN1C(=O)N(C2CCCCC2)[C@H](N(O)C(=O)NC2CCCCC2)C1(C)C |
| InChI | InChI=1S/C23H42N4O3/c1-17(2)15-16-25-22(29)26(19-13-9-6-10-14-19)20(23(25,3)4)27(30)21(28)24-18-11-7-5-8-12-18/h17-20,30H,5-16H2,1-4H3,(H,24,28)/t20-/m1/s1 |
| InChIKey | PRHILGZPAVBMHH-HXUWFJFHSA-N |
| XLogP | 4.94 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|