C21H29N3O5S — CID 32902455
(3R,7aR)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 32902455) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is (3R,7aR)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aR)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 32902455 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (3R,7aR)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)CN(C)C(=O)[C@@H]2CS[C@]3(C)CCC(=O)N23)cc1OCC |
| InChI | InChI=1S/C21H29N3O5S/c1-5-28-16-8-7-14(11-17(16)29-6-2)22-18(25)12-23(4)20(27)15-13-30-21(3)10-9-19(26)24(15)21/h7-8,11,15H,5-6,9-10,12-13H2,1-4H3,(H,22,25)/t15-,21+/m0/s1 |
| InChIKey | SIYXXJBSMNMFDO-YCRPNKLZSA-N |
| XLogP | 2.33 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |