C18H19ClF3N3O3S — CID 24982623
N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 24982623) has the molecular formula C18H19ClF3N3O3S and a molecular weight of 449.88 g/mol. Its IUPAC name is N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 24982623 |
| Molecular Formula | C18H19ClF3N3O3S |
| Molecular Weight | 449.88 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)C1CSC2(C)CCC(=O)N12 |
| InChI | InChI=1S/C18H19ClF3N3O3S/c1-17-6-5-15(27)25(17)13(9-29-17)16(28)24(2)8-14(26)23-10-3-4-12(19)11(7-10)18(20,21)22/h3-4,7,13H,5-6,8-9H2,1-2H3,(H,23,26) |
| InChIKey | RZJNODXJQZGPQZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |