C17H22N4O5S — CID 32905464
1-(3,4-dimethylphenyl)sulfonyl-N-(2,4-dioxoimidazolidin-1-yl)piperidine-4-carboxamide (PubChem CID 32905464) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-N-(2,4-dioxoimidazolidin-1-yl)piperidine-4-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-N-(2,4-dioxoimidazolidin-1-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 32905464 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-N-(2,4-dioxoimidazolidin-1-yl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NN3CC(=O)NC3=O)CC2)cc1C |
| InChI | InChI=1S/C17H22N4O5S/c1-11-3-4-14(9-12(11)2)27(25,26)20-7-5-13(6-8-20)16(23)19-21-10-15(22)18-17(21)24/h3-4,9,13H,5-8,10H2,1-2H3,(H,19,23)(H,18,22,24) |
| InChIKey | ODUGKZFHIFPNHJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|