C19H17Cl2FN2O — CID 3291293
1-(2,4-dichlorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 3291293) has the molecular formula C19H17Cl2FN2O and a molecular weight of 379.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3291293 |
| Molecular Formula | C19H17Cl2FN2O |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCN(c2ccc(F)cc2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2FN2O/c20-14-1-6-17(18(21)13-14)19(25)7-8-23-9-11-24(12-10-23)16-4-2-15(22)3-5-16/h1-8,13H,9-12H2 |
| InChIKey | QNKRSVCEMCQMOM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|