C16H10N2O4-2 — CID 3292528
2,8-dimethylpyrido[3,2-g]quinoline-4,6-dicarboxylate (PubChem CID 3292528) has the molecular formula C16H10N2O4-2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2,8-dimethylpyrido[3,2-g]quinoline-4,6-dicarboxylate.
| Compound Name | 2,8-dimethylpyrido[3,2-g]quinoline-4,6-dicarboxylate |
|---|---|
| PubChem CID | 3292528 |
| Molecular Formula | C16H10N2O4-2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2,8-dimethylpyrido[3,2-g]quinoline-4,6-dicarboxylate |
| SMILES | Cc1cc(C(=O)[O-])c2cc3c(C(=O)[O-])cc(C)nc3cc2n1 |
| InChI | InChI=1S/C16H12N2O4/c1-7-3-11(15(19)20)9-5-10-12(16(21)22)4-8(2)18-14(10)6-13(9)17-7/h3-6H,1-2H3,(H,19,20)(H,21,22)/p-2 |
| InChIKey | VPPPQZDTHYLDSP-UHFFFAOYSA-L |
| XLogP | 0.13 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|