C11H6Cl2NO2- — CID 7200781
5,7-dichloro-2-methylquinoline-4-carboxylate (PubChem CID 7200781) has the molecular formula C11H6Cl2NO2- and a molecular weight of 255.08 g/mol. Its IUPAC name is 5,7-dichloro-2-methylquinoline-4-carboxylate.
| Compound Name | 5,7-dichloro-2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7200781 |
| Molecular Formula | C11H6Cl2NO2- |
| Molecular Weight | 255.08 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 5,7-dichloro-2-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)[O-])c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C11H7Cl2NO2/c1-5-2-7(11(15)16)10-8(13)3-6(12)4-9(10)14-5/h2-4H,1H3,(H,15,16)/p-1 |
| InChIKey | HJXCDEDXEDDWDF-UHFFFAOYSA-M |
| XLogP | 2.21 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.08 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |