C14H16Cl2N2 — CID 82577818
4-(5,7-dichloro-2-methylquinolin-4-yl)butan-1-amine (PubChem CID 82577818) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 4-(5,7-dichloro-2-methylquinolin-4-yl)butan-1-amine.
| Compound Name | 4-(5,7-dichloro-2-methylquinolin-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 82577818 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-(5,7-dichloro-2-methylquinolin-4-yl)butan-1-amine |
| SMILES | Cc1cc(CCCCN)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C14H16Cl2N2/c1-9-6-10(4-2-3-5-17)14-12(16)7-11(15)8-13(14)18-9/h6-8H,2-5,17H2,1H3 |
| InChIKey | VAMBWBWTAGIDPA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|