C13H9Cl2N3S — CID 82449443
4-(5,7-dichloro-2-methylquinolin-4-yl)-1,3-thiazol-2-amine (PubChem CID 82449443) has the molecular formula C13H9Cl2N3S and a molecular weight of 310.21 g/mol. Its IUPAC name is 4-(5,7-dichloro-2-methylquinolin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(5,7-dichloro-2-methylquinolin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82449443 |
| Molecular Formula | C13H9Cl2N3S |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 4-(5,7-dichloro-2-methylquinolin-4-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(-c2csc(N)n2)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C13H9Cl2N3S/c1-6-2-8(11-5-19-13(16)18-11)12-9(15)3-7(14)4-10(12)17-6/h2-5H,1H3,(H2,16,18) |
| InChIKey | RQNJNHTYGJUVSN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |