C20H22NO3- — CID 3297532
4-anilino-3-[(3,5-dimethylphenyl)methyl]-2-methyl-4-oxobutanoate (PubChem CID 3297532) has the molecular formula C20H22NO3- and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-anilino-3-[(3,5-dimethylphenyl)methyl]-2-methyl-4-oxobutanoate.
| Compound Name | 4-anilino-3-[(3,5-dimethylphenyl)methyl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 3297532 |
| Molecular Formula | C20H22NO3- |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-anilino-3-[(3,5-dimethylphenyl)methyl]-2-methyl-4-oxobutanoate |
| SMILES | Cc1cc(C)cc(CC(C(=O)Nc2ccccc2)C(C)C(=O)[O-])c1 |
| InChI | InChI=1S/C20H23NO3/c1-13-9-14(2)11-16(10-13)12-18(15(3)20(23)24)19(22)21-17-7-5-4-6-8-17/h4-11,15,18H,12H2,1-3H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | DDUJKVMTEJMQQH-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |