C20H24N2O5 — CID 32993659
N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetamide (PubChem CID 32993659) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 32993659 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(2-methoxyethyl)-2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetamide |
| SMILES | COCCN(Cc1ccco1)C(=O)COc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-25-13-11-21(14-18-4-3-12-26-18)20(24)15-27-17-8-6-16(7-9-17)22-10-2-5-19(22)23/h3-4,6-9,12H,2,5,10-11,13-15H2,1H3 |
| InChIKey | IYLMEMBUALLDFV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |