C14H11FN2OS2 — CID 3299551
6-ethyl-3-(3-fluorophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 3299551) has the molecular formula C14H11FN2OS2 and a molecular weight of 306.39 g/mol. Its IUPAC name is 6-ethyl-3-(3-fluorophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-3-(3-fluorophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3299551 |
| Molecular Formula | C14H11FN2OS2 |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 6-ethyl-3-(3-fluorophenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(-c3cccc(F)c3)c(=S)[nH]c2s1 |
| InChI | InChI=1S/C14H11FN2OS2/c1-2-10-7-11-12(20-10)16-14(19)17(13(11)18)9-5-3-4-8(15)6-9/h3-7H,2H2,1H3,(H,16,19) |
| InChIKey | IFGBYWQTMDJHPT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|