C18H20N2OS2 — CID 27518678
3-[4-[(2R)-butan-2-yl]phenyl]-6-ethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 27518678) has the molecular formula C18H20N2OS2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 3-[4-[(2R)-butan-2-yl]phenyl]-6-ethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[4-[(2R)-butan-2-yl]phenyl]-6-ethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 27518678 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-[4-[(2R)-butan-2-yl]phenyl]-6-ethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(-c3ccc([C@H](C)CC)cc3)c(=S)[nH]c2s1 |
| InChI | InChI=1S/C18H20N2OS2/c1-4-11(3)12-6-8-13(9-7-12)20-17(21)15-10-14(5-2)23-16(15)19-18(20)22/h6-11H,4-5H2,1-3H3,(H,19,22)/t11-/m1/s1 |
| InChIKey | VRBXPEUHCIHTCA-LLVKDONJSA-N |
| XLogP | 5.19 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|