C17H16N3O2S+ — CID 3303644
2-amino-N-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-carboxamide (PubChem CID 3303644) has the molecular formula C17H16N3O2S+ and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-amino-N-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-carboxamide.
| Compound Name | 2-amino-N-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-carboxamide |
|---|---|
| PubChem CID | 3303644 |
| Molecular Formula | C17H16N3O2S+ |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-amino-N-(4-methoxyphenyl)-4-phenyl-1,3-thiazol-3-ium-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sc(N)[nH+]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c1-22-13-9-7-12(8-10-13)19-16(21)15-14(20-17(18)23-15)11-5-3-2-4-6-11/h2-10H,1H3,(H2,18,20)(H,19,21)/p+1 |
| InChIKey | UYQYKFCAEVZZCW-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |