C29H34N6O5S2 — CID 3303756
N-[[4-(2,3-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide (PubChem CID 3303756) has the molecular formula C29H34N6O5S2 and a molecular weight of 610.76 g/mol. Its IUPAC name is N-[[4-(2,3-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[4-(2,3-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3303756 |
| Molecular Formula | C29H34N6O5S2 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | N-[[4-(2,3-dimethylphenyl)-5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2nnc(SCC(=O)Nc3nccs3)n2-c2cccc(C)c2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C29H34N6O5S2/c1-6-38-22-14-20(15-23(39-7-2)26(22)40-8-3)27(37)31-16-24-33-34-29(35(24)21-11-9-10-18(4)19(21)5)42-17-25(36)32-28-30-12-13-41-28/h9-15H,6-8,16-17H2,1-5H3,(H,31,37)(H,30,32,36) |
| InChIKey | GWECBOLWPNPGGH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |