C29H28N6O4S2 — CID 3516409
N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide (PubChem CID 3516409) has the molecular formula C29H28N6O4S2 and a molecular weight of 588.72 g/mol. Its IUPAC name is N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 3516409 |
| Molecular Formula | C29H28N6O4S2 |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(2,3-dimethylphenyl)-1,2,4-triazol-3-yl]methyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCc2nnc(SCC(=O)Nc3nc4ccccc4s3)n2-c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C29H28N6O4S2/c1-17-8-7-10-23(18(17)2)35-25(15-30-27(37)19-12-20(38-3)14-21(13-19)39-4)33-34-29(35)40-16-26(36)32-28-31-22-9-5-6-11-24(22)41-28/h5-14H,15-16H2,1-4H3,(H,30,37)(H,31,32,36) |
| InChIKey | SQFYBBBJGSLIPG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |