C26H21N7O4S2 — CID 4687529
N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide (PubChem CID 4687529) has the molecular formula C26H21N7O4S2 and a molecular weight of 559.63 g/mol. Its IUPAC name is N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide.
| Compound Name | N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4687529 |
| Molecular Formula | C26H21N7O4S2 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
| SMILES | Cc1cccc(-n2c(CNC(=O)c3ccc([N+](=O)[O-])cc3)nnc2SCC(=O)Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C26H21N7O4S2/c1-16-5-4-6-19(13-16)32-22(14-27-24(35)17-9-11-18(12-10-17)33(36)37)30-31-26(32)38-15-23(34)29-25-28-20-7-2-3-8-21(20)39-25/h2-13H,14-15H2,1H3,(H,27,35)(H,28,29,34) |
| InChIKey | FCLTYDQTNPOBEV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|