C31H31BrN6O5S2 — CID 3354909
N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(4-bromophenyl)-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide (PubChem CID 3354909) has the molecular formula C31H31BrN6O5S2 and a molecular weight of 711.66 g/mol. Its IUPAC name is N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(4-bromophenyl)-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(4-bromophenyl)-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3354909 |
| Molecular Formula | C31H31BrN6O5S2 |
| Molecular Weight | 711.66 g/mol |
| Exact Mass | 710.10 |
| IUPAC Name | N-[[5-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanyl-4-(4-bromophenyl)-1,2,4-triazol-3-yl]methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2nnc(SCC(=O)Nc3nc4ccccc4s3)n2-c2ccc(Br)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C31H31BrN6O5S2/c1-4-41-23-15-19(16-24(42-5-2)28(23)43-6-3)29(40)33-17-26-36-37-31(38(26)21-13-11-20(32)12-14-21)44-18-27(39)35-30-34-22-9-7-8-10-25(22)45-30/h7-16H,4-6,17-18H2,1-3H3,(H,33,40)(H,34,35,39) |
| InChIKey | BCIDPJRDRWEGGE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |