C23H20N4O2 — CID 3304664
6-(4-phenylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one (PubChem CID 3304664) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-(4-phenylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 6-(4-phenylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 3304664 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 6-(4-phenylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one |
| SMILES | O=C(c1cccn2c(=O)c3ccccc3nc12)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H20N4O2/c28-22(26-15-13-25(14-16-26)17-7-2-1-3-8-17)19-10-6-12-27-21(19)24-20-11-5-4-9-18(20)23(27)29/h1-12H,13-16H2 |
| InChIKey | QEPHTORLWZTOEC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|