C22H20N5O2+ — CID 5083314
6-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one (PubChem CID 5083314) has the molecular formula C22H20N5O2+ and a molecular weight of 386.44 g/mol. Its IUPAC name is 6-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 6-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 5083314 |
| Molecular Formula | C22H20N5O2+ |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 6-(4-pyridin-1-ium-2-ylpiperazine-1-carbonyl)pyrido[2,1-b]quinazolin-11-one |
| SMILES | O=C(c1cccn2c(=O)c3ccccc3nc12)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C22H19N5O2/c28-21(26-14-12-25(13-15-26)19-9-3-4-10-23-19)17-7-5-11-27-20(17)24-18-8-2-1-6-16(18)22(27)29/h1-11H,12-15H2/p+1 |
| InChIKey | HFFAHNMPSUYDRO-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 72.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|