C23H22N4O2S — CID 15994215
10-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-4-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),5,8,10,12-pentaen-2-one (PubChem CID 15994215) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 10-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-4-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),5,8,10,12-pentaen-2-one.
| Compound Name | 10-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-4-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),5,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 15994215 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 10-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]-4-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),5,8,10,12-pentaen-2-one |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)c3cccn4c(=O)c5sccc5nc34)CC2)c1 |
| InChI | InChI=1S/C23H22N4O2S/c1-15-5-6-16(2)19(14-15)25-9-11-26(12-10-25)22(28)17-4-3-8-27-21(17)24-18-7-13-30-20(18)23(27)29/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | SKTBNTFBPSOUNU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |