C33H28FN3O5S2 — CID 3305823
3-(1-benzofuran-2-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-pentoxyphenyl)-2H-pyrrol-5-one (PubChem CID 3305823) has the molecular formula C33H28FN3O5S2 and a molecular weight of 629.74 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-pentoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-pentoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3305823 |
| Molecular Formula | C33H28FN3O5S2 |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-hydroxy-2-(4-pentoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCCCCOc1ccc(C2C(C(=O)c3cc4ccccc4o3)=C(O)C(=O)N2c2nnc(SCc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C33H28FN3O5S2/c1-2-3-6-17-41-24-15-11-21(12-16-24)28-27(29(38)26-18-22-7-4-5-8-25(22)42-26)30(39)31(40)37(28)32-35-36-33(44-32)43-19-20-9-13-23(34)14-10-20/h4-5,7-16,18,28,39H,2-3,6,17,19H2,1H3 |
| InChIKey | KXVCOVPOFAYGAQ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|